On Target 5HT1E_HUMAN 0.3152174/CHEMBL29410
For the given ligand CAR, we have found in our database that, being scored 0.3152174, the most similar ligand is CHEMBL29410. Check out the elaboration below.
| CAR (Given Ligand) | CHEMBL29410 (Similar Ligand) |
|---|---|
| CN(C)C(=O)N[C@@H]3CC[C@@H](CCN2CCN(c1cccc(Cl)c1Cl)CC2)CC3.Cl | COc1ccc(NS(=O)(=O)c2sc3ccc(Cl)cc3c2C)cc1N1CCN2CCCCC2C1 |
|
|
|
|
|
|
| 0000c002 01001000 00100020 05000e00 00000000 00000000 08000004 28002000 00000000 00000ac0 00200004 40018800 02009006 00002001 00000040 00000000 00040000 10000000 0a002000 00004201 40100100 38050510 20000021 0211001a 00012000 00100400 00000000 10000080 08008000 00060001 000a0000 00020200 | 0001c012 11800008 21100b2a 04b90600 a0181000 00402010 06020000 20000008 00000040 00408ac0 04202204 70018880 0204160e 00022001 813a11c1 00024408 00042088 02002400 08c02000 00026201 c0100000 78000998 200400e1 0b50821a 00882080 a4102000 20040400 1001008c 08808604 20060000 00000c00 00c30660 |