On Target ADA2C_HUMAN 0.42957747/CHEMBL1112
For the given ligand CAR, we have found in our database that, being scored 0.42957747, the most similar ligand is CHEMBL1112. Check out the elaboration below.
| CAR (Given Ligand) | CHEMBL1112 (Similar Ligand) |
|---|---|
| CN(C)C(=O)N[C@@H]3CC[C@@H](CCN2CCN(c1cccc(Cl)c1Cl)CC2)CC3.Cl | O=C1CCc2ccc(OCCCCN3CCN(c4cccc(Cl)c4Cl)CC3)cc2N1 |
|
|
|
|
|
|
| 0000c002 01001000 00100020 05000e00 00000000 00000000 08000004 28002000 00000000 00000ac0 00200004 40018800 02009006 00002001 00000040 00000000 00040000 10000000 0a002000 00004201 40100100 38050510 20000021 0211001a 00012000 00100400 00000000 10000080 08008000 00060001 000a0000 00020200 | 0400c002 80000208 20100128 05010700 30101000 06002040 0a040000 28000000 00000800 00080ac0 08380024 40009800 06808006 08102001 11020041 000c2008 00048080 12000000 08400008 00026601 40100100 38000700 21002021 02410012 00002800 81100400 00120210 10001080 08008200 0006000b 00000000 20020e00 |