On Target TSHR_HUMAN 0.34586465/CHEMBL3911383
For the given ligand CAR, we have found in our database that, being scored 0.34586465, the most similar ligand is CHEMBL3911383. Check out the elaboration below.
| CAR (Given Ligand) | CHEMBL3911383 (Similar Ligand) |
|---|---|
| CN(C)C(=O)N[C@@H]3CC[C@@H](CCN2CCN(c1cccc(Cl)c1Cl)CC2)CC3.Cl | CC(=O)N1c2ccc(NC(=O)CCc3ccc(Cl)cc3)cc2C(C)(c2ccccc2)CC1(C)C |
|
|
|
|
|
|
| 0000c002 01001000 00100020 05000e00 00000000 00000000 08000004 28002000 00000000 00000ac0 00200004 40018800 02009006 00002001 00000040 00000000 00040000 10000000 0a002000 00004201 40100100 38050510 20000021 0211001a 00012000 00100400 00000000 10000080 08008000 00060001 000a0000 00020200 | 0800c002 01001200 40100102 00010600 24000020 00082040 01000000 21000000 00400800 000808d0 08380024 40009800 06008026 00300800 00020040 00040000 00048000 02000001 08000008 00000201 44100100 18040700 20002000 00400018 00042800 a1000000 00040010 50001080 00488080 0006000b 00000080 20020600 |