On Target 5HT1B_HUMAN 0.45689654/CHEMBL370128
For the given ligand CAR, we have found in our database that, being scored 0.45689654, the most similar ligand is CHEMBL370128. Check out the elaboration below.
| CAR (Given Ligand) | CHEMBL370128 (Similar Ligand) |
|---|---|
| CN(C)C(=O)N[C@@H]3CC[C@@H](CCN2CCN(c1cccc(Cl)c1Cl)CC2)CC3.Cl | COc1ccc(NC(=O)N2CCN(c3ccccc3Cl)CC2)cc1N1CCN(C)CC1 |
|
|
|
|
|
|
| 0000c002 01001000 00100020 05000e00 00000000 00000000 08000004 28002000 00000000 00000ac0 00200004 40018800 02009006 00002001 00000040 00000000 00040000 10000000 0a002000 00004201 40100100 38050510 20000021 0211001a 00012000 00100400 00000000 10000080 08008000 00060001 000a0000 00020200 | 0000c006 00002008 20000028 04010e00 88001000 00000000 02000804 08002009 00000000 00020a40 00280004 40008800 0200a026 00102000 01000041 00004008 00040010 10400000 08000000 00020000 40100100 28010500 20022020 0201800a 00182000 00300400 20040400 00000080 08808200 00060001 00000800 00024200 |