On Target CXCR4_HUMAN 0.37623763/CHEMBL2347625
For the given ligand CAR, we have found in our database that, being scored 0.37623763, the most similar ligand is CHEMBL2347625. Check out the elaboration below.
| CAR (Given Ligand) | CHEMBL2347625 (Similar Ligand) |
|---|---|
| CN(C)C(=O)N[C@@H]3CC[C@@H](CCN2CCN(c1cccc(Cl)c1Cl)CC2)CC3.Cl | N=C(NCCCN(CCCCN(CCCNC(=N)Nc1ccccc1)C(=N)Nc1ccccc1)C(=N)Nc1ccccc1)Nc1ccccc1 |
|
|
|
|
|
|
| 0000c002 01001000 00100020 05000e00 00000000 00000000 08000004 28002000 00000000 00000ac0 00200004 40018800 02009006 00002001 00000040 00000000 00040000 10000000 0a002000 00004201 40100100 38050510 20000021 0211001a 00012000 00100400 00000000 10000080 08008000 00060001 000a0000 00020200 | 00000006 00000410 00100000 00000e00 00000000 00000000 00000004 20002001 00200200 000009e2 00200004 40028000 00001002 00000000 00000040 00100000 00040000 00400000 08000000 00000201 40020100 18010000 20020000 00000010 00110000 00000000 40000000 10000080 00008010 00060011 80180000 04006200 |