On Target CCKAR_HUMAN 0.45736435/CHEMBL357983
For the given ligand CAR, we have found in our database that, being scored 0.45736435, the most similar ligand is CHEMBL357983. Check out the elaboration below.
| CAR (Given Ligand) | CHEMBL357983 (Similar Ligand) |
|---|---|
| CN(C)C(=O)N[C@@H]3CC[C@@H](CCN2CCN(c1cccc(Cl)c1Cl)CC2)CC3.Cl | COc1ccc(N(C(=O)CN(C(=O)[C@@H](CCC(=O)O)NC(=O)Nc2ccccc2)c2ccccc2)C(C)C)cc1 |
|
|
|
|
|
|
| 0000c002 01001000 00100020 05000e00 00000000 00000000 08000004 28002000 00000000 00000ac0 00200004 40018800 02009006 00002001 00000040 00000000 00040000 10000000 0a002000 00004201 40100100 38050510 20000021 0211001a 00012000 00100400 00000000 10000080 08008000 00060001 000a0000 00020200 | 00034006 01003008 20100028 04000e00 20181000 00002000 02000004 20002009 00000000 00020ac0 00280004 4001b000 0600b032 01102001 81020041 00080008 00040010 00400000 08400000 00020201 40100100 38050e00 21022003 0210001a 00110000 00000080 00040000 10000080 08008200 00060001 20085000 00804a00 |