On Target ACM2_HUMAN 0.4473684/CHEMBL310132
For the given ligand CAR, we have found in our database that, being scored 0.4473684, the most similar ligand is CHEMBL310132. Check out the elaboration below.
| CAR (Given Ligand) | CHEMBL310132 (Similar Ligand) |
|---|---|
| CN(C)C(=O)N[C@@H]3CC[C@@H](CCN2CCN(c1cccc(Cl)c1Cl)CC2)CC3.Cl | O=C(c1ccccc1)N(c1ccc(Cl)c(Cl)c1)C1CCN(Cc2ccccc2)CC1 |
|
|
|
|
|
|
| 0000c002 01001000 00100020 05000e00 00000000 00000000 08000004 28002000 00000000 00000ac0 00200004 40018800 02009006 00002001 00000040 00000000 00040000 10000000 0a002000 00004201 40100100 38050510 20000021 0211001a 00012000 00100400 00000000 10000080 08008000 00060001 000a0000 00020200 | 0000c002 01001c00 00100100 01010600 20000000 00000000 08000000 22001000 00000000 000009e0 00280004 5001c800 02008806 00100001 00020440 00000000 00040000 02000000 08000000 00004201 60100000 180a8700 20012000 0050001c 00002000 c0100000 00080000 90000080 00008100 00060011 a0040000 02020200 |