On Target GRM4_HUMAN 0.5104167/CHEMBL578358
For the given ligand CAR, we have found in our database that, being scored 0.5104167, the most similar ligand is CHEMBL578358. Check out the elaboration below.
| CAR (Given Ligand) | CHEMBL578358 (Similar Ligand) |
|---|---|
| CN(C)C(=O)N[C@@H]3CC[C@@H](CCN2CCN(c1cccc(Cl)c1Cl)CC2)CC3.Cl | NC(=O)[C@@H]1CCCC[C@@H]1C(=O)Nc1cc(Cl)cc(Cl)c1 |
|
|
|
|
|
|
| 0000c002 01001000 00100020 05000e00 00000000 00000000 08000004 28002000 00000000 00000ac0 00200004 40018800 02009006 00002001 00000040 00000000 00040000 10000000 0a002000 00004201 40100100 38050510 20000021 0211001a 00012000 00100400 00000000 10000080 08008000 00060001 000a0000 00020200 | 0003c002 01000000 00100000 01000600 20000000 00002020 08000000 00000000 00200000 000008c0 00280004 40039800 0600800c 00100401 00020040 00000000 00040000 00000000 0a002000 00004001 40100000 18000710 20002000 00100010 00002000 00000000 00000000 10000080 00008002 00060001 00020000 00820200 |