On Target HRH1_HUMAN 0.4774775/CHEMBL476935
For the given ligand CAR, we have found in our database that, being scored 0.4774775, the most similar ligand is CHEMBL476935. Check out the elaboration below.
| CAR (Given Ligand) | CHEMBL476935 (Similar Ligand) |
|---|---|
| CN(C)C(=O)N[C@@H]3CC[C@@H](CCN2CCN(c1cccc(Cl)c1Cl)CC2)CC3.Cl | O=C(CCCN1CCN(c2ccc(Cl)cc2)CC1)c1ccc(F)cc1 |
|
|
|
|
|
|
| 0000c002 01001000 00100020 05000e00 00000000 00000000 08000004 28002000 00000000 00000ac0 00200004 40018800 02009006 00002001 00000040 00000000 00040000 10000000 0a002000 00004201 40100100 38050510 20000021 0211001a 00012000 00100400 00000000 10000080 08008000 00060001 000a0000 00020200 | 0002c002 01000800 00100122 06010600 00000000 00000010 00000000 20000000 00100800 00080ac0 08300004 40019800 06008006 00203000 00200040 00000000 00040000 02000080 08000000 00100201 40100100 38020300 20000021 02500016 00002000 80000000 00080000 10000081 08008000 00068002 80000000 02820600 |