On Target 5HT4R_HUMAN 0.37414965/CHEMBL539651
For the given ligand CAR, we have found in our database that, being scored 0.37414965, the most similar ligand is CHEMBL539651. Check out the elaboration below.
| CAR (Given Ligand) | CHEMBL539651 (Similar Ligand) |
|---|---|
| CN(C)C(=O)N[C@@H]3CC[C@@H](CCN2CCN(c1cccc(Cl)c1Cl)CC2)CC3.Cl | CC(C)n1c(=O)c(C(=O)N[C@@H]2C[C@@H]3CC[C@H](C2)N3CCCCCCCN2CCN(c3ccccc3)CC2)cc2ccccc21 |
|
|
|
|
|
|
| 0000c002 01001000 00100020 05000e00 00000000 00000000 08000004 28002000 00000000 00000ac0 00200004 40018800 02009006 00002001 00000040 00000000 00040000 10000000 0a002000 00004201 40100100 38050510 20000021 0211001a 00012000 00100400 00000000 10000080 08008000 00060001 000a0000 00020200 | 10004002 0180dc00 00104120 04010610 00041002 00000070 00004000 22001000 06000001 40000be0 05200004 50018000 00009802 00602000 00100440 00040004 00060000 82000004 08202000 00000201 c0100000 380e8e18 20800021 8270001e 00040000 c0000000 08800000 90001080 08408100 00060051 e00e0000 80002200 |