On Target CCR2_HUMAN 0.57843137/CHEMBL2036748
For the given ligand CAR, we have found in our database that, being scored 0.57843137, the most similar ligand is CHEMBL2036748. Check out the elaboration below.
| CAR (Given Ligand) | CHEMBL2036748 (Similar Ligand) |
|---|---|
| CN(C)C(=O)N[C@@H]3CC[C@@H](CCN2CCN(c1cccc(Cl)c1Cl)CC2)CC3.Cl | CN1CCCC(CN2CCN(C(=O)Nc3ccc(Cl)c(Cl)c3)CC2)C1 |
|
|
|
|
|
|
| 0000c002 01001000 00100020 05000e00 00000000 00000000 08000004 28002000 00000000 00000ac0 00200004 40018800 02009006 00002001 00000040 00000000 00040000 10000000 0a002000 00004201 40100100 38050510 20000021 0211001a 00012000 00100400 00000000 10000080 08008000 00060001 000a0000 00020200 | 00008006 01002400 00100000 06000e00 00000000 00000000 08000004 20002009 00000000 000209e0 00280004 50018800 0200a006 00102001 00000040 00000000 00040010 00400000 08000000 00004201 40000100 38010520 20022021 02100018 00102000 00100000 00080000 10000080 08008000 00060011 00000000 02026200 |