On Target CXCR2_HUMAN 0.4028777/CHEMBL4103634
For the given ligand CAR, we have found in our database that, being scored 0.4028777, the most similar ligand is CHEMBL4103634. Check out the elaboration below.
| CAR (Given Ligand) | CHEMBL4103634 (Similar Ligand) |
|---|---|
| CN(C)C(=O)N[C@@H]3CC[C@@H](CCN2CCN(c1cccc(Cl)c1Cl)CC2)CC3.Cl | CC1CCCCC1NC(=O)Nc1ccc(Cl)c(S(=O)(=O)C(C)C)c1O |
|
|
|
|
|
|
| 0000c002 01001000 00100020 05000e00 00000000 00000000 08000004 28002000 00000000 00000ac0 00200004 40018800 02009006 00002001 00000040 00000000 00040000 10000000 0a002000 00004201 40100100 38050510 20000021 0211001a 00012000 00100400 00000000 10000080 08008000 00060001 000a0000 00020200 | 00009006 05b01208 20120000 02900e00 00000200 00020000 12001004 00002001 00080000 000048c0 00682004 60018840 02009007 00140002 80200140 00004008 04040200 08400000 0a002000 00022001 c0000102 18050510 20822000 08110019 0011a000 00080000 20080840 10000080 00008000 00060001 100a0000 02034224 |