On Target ADA2B_HUMAN 0.15/CHEMBL972
For the given ligand h, we have found in our database that, being scored 0.15, the most similar ligand is CHEMBL972. Check out the elaboration below.
| h (Given Ligand) | CHEMBL972 (Similar Ligand) |
|---|---|
| c1ccccc1 | C[C@H](Cc1ccccc1)N(C)CC#C |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000200 00000000 00000000 00000000 00000000 00000000 00000840 00000000 00008000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 08000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00020000 00000000 00000000 | 00000000 00000000 00100100 00010600 00402000 00000000 00000000 00100000 00000880 00080840 08300000 40008000 00000002 00000000 00100000 00000000 00000000 02000000 00000000 00000201 00000100 18200000 00010000 81400010 00000000 80000000 00000000 00000000 04000000 00060002 00000020 00000600 |