On Target ADA2A_HUMAN 0.17142858/CHEMBL3289522
For the given ligand h, we have found in our database that, being scored 0.17142858, the most similar ligand is CHEMBL3289522. Check out the elaboration below.
| h (Given Ligand) | CHEMBL3289522 (Similar Ligand) |
|---|---|
| c1ccccc1 | Cl.CN(C)c1ccc(NC(=N)Nc2ccccc2)cc1 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000200 00000000 00000000 00000000 00000000 00000000 00000840 00000000 00008000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 08000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00020000 00000000 00000000 | 00000006 00001010 00000000 00000a40 00000000 00000000 00000000 00002001 00000000 00000842 00200004 00008000 00000000 00000000 00000040 00000000 00040000 00000000 08000000 00000000 40020100 08040000 20020000 00000000 00100000 00000000 40000000 00000080 00008010 00060000 00000000 04024000 |