On Target GRM4_HUMAN 0.08955224/CHEMBL578358
For the given ligand h, we have found in our database that, being scored 0.08955224, the most similar ligand is CHEMBL578358. Check out the elaboration below.
| h (Given Ligand) | CHEMBL578358 (Similar Ligand) |
|---|---|
| c1ccccc1 | NC(=O)[C@@H]1CCCC[C@@H]1C(=O)Nc2cc(Cl)cc(Cl)c2 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000200 00000000 00000000 00000000 00000000 00000000 00000840 00000000 00008000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 08000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00020000 00000000 00000000 | 0003c002 01000000 00100000 01000600 20000000 00002020 08000000 00000000 00200000 000008c0 00280004 40039800 0600800c 00100401 00020040 00000000 00040000 00000000 0a002000 00004001 40100000 18000710 20002000 00100010 00002000 00000000 00000000 10000080 00008002 00060001 00020000 00820200 |