On Target EDNRA_HUMAN 0.36734694/CHEMBL10832
For the given ligand CBD, we have found in our database that, being scored 0.36734694, the most similar ligand is CHEMBL10832. Check out the elaboration below.
| CBD (Given Ligand) | CHEMBL10832 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)cc2O | [Na+].COc1ccc(cc1)C(=O)\C(=C(/C(=O)[O-])\c2ccc3OCOc3c2)\Cc4ccc(OC)c(OC)c4OC |
|
|
|
|
|
|
| 00000001 43000008 20000102 00010202 00010000 40800000 02000001 00000602 00040900 00980842 08100000 40408840 00020002 00200000 00000400 00002008 00000000 02100020 00202000 00020a01 00000100 08000000 00008000 00400010 00200000 80000000 04404200 80000000 00000002 00024002 24020000 00010400 | 00000001 43000c08 2000030b 00010202 00001041 40800000 c6040081 00000600 01a40800 00b80840 48100000 40109040 0500c002 20200000 41040003 002aa008 08000400 02100004 00298018 00020a01 00040300 08020a80 01008001 00400414 41201800 c4004400 00522000 60010000 01400300 0002410a 84002000 00010d00 |