On Target GRM6_HUMAN 0.12953368/CHEMBL4101970
For the given ligand CBD, we have found in our database that, being scored 0.12953368, the most similar ligand is CHEMBL4101970. Check out the elaboration below.
| CBD (Given Ligand) | CHEMBL4101970 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)cc2O | N[C@@H](CCP(=O)(O)[C@H](O)c1cc(F)c(O)c(c1)[N+](=O)[O-])C(=O)O |
|
|
|
|
|
|
| 00000001 43000008 20000102 00010202 00010000 40800000 02000001 00000602 00040900 00980842 08100000 40408840 00020002 00200000 00000400 00002008 00000000 02100020 00202000 00020a01 00000100 08000000 00008000 00400010 00200000 80000000 04404200 80000000 00000002 00024002 24020000 00010400 | 08000002 02800a18 21504104 02010600 00000000 00004010 02002000 84000000 14000140 40046860 04000005 7010b000 04058242 04061000 a6198144 10084018 02001828 02300000 00410500 90030201 40020000 19500a20 23400000 20400410 00040000 c2010002 03422000 00016011 60440600 10068300 50000080 0400d205 |