On Target V1AR_HUMAN 0.33774835/CHEMBL430676
For the given ligand CBD, we have found in our database that, being scored 0.33774835, the most similar ligand is CHEMBL430676. Check out the elaboration below.
| CBD (Given Ligand) | CHEMBL430676 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)cc2O | COc1cccc(OC)c1C(=O)Nc2ccc(cc2)C(=O)N3CCC4(CCCC=C4)Cc5ccccc35 |
|
|
|
|
|
|
| 00000001 43000008 20000102 00010202 00010000 40800000 02000001 00000602 00040900 00980842 08100000 40408840 00020002 00200000 00000400 00002008 00000000 02100020 00202000 00020a01 00000100 08000000 00008000 00400010 00200000 80000000 04404200 80000000 00000002 00024002 24020000 00010400 | 00004003 01001808 2010011a 80110600 20001000 00022140 43000000 22001402 10100800 081808c2 08380024 4001c000 00028802 00308000 01020441 0000200a 0004c000 02000024 08002008 00020a01 40100100 18068610 2001a000 0054001c 00200000 c0000000 00400810 90001080 04088302 00060003 a4060080 20010600 |