On Target AA2BR_HUMAN 0.21556886/CHEMBL3317578
For the given ligand CBD, we have found in our database that, being scored 0.21556886, the most similar ligand is CHEMBL3317578. Check out the elaboration below.
| CBD (Given Ligand) | CHEMBL3317578 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)cc2O | Nc1nc(CCCc2ccccc2O)nc3cn(nc13)c4ccccc4 |
|
|
|
|
|
|
| 00000001 43000008 20000102 00010202 00010000 40800000 02000001 00000602 00040900 00980842 08100000 40408840 00020002 00200000 00000400 00002008 00000000 02100020 00202000 00020a01 00000100 08000000 00008000 00400010 00200000 80000000 04404200 80000000 00000002 00024002 24020000 00010400 | 0000000e 81800208 20081502 18090620 01080060 0000c000 07009010 00001a00 10100900 000d18c0 09108004 40819040 00000802 00a00000 000200c0 020c200c 10000000 06000008 01600008 00260401 c0000100 18018060 25800840 83400010 00100000 80000000 08010000 00000880 0400000c 00c6480a 40040000 a02405e0 |