On Target CCR4_HUMAN 0.25892857/CHEMBL1618631
For the given ligand CBD, we have found in our database that, being scored 0.25892857, the most similar ligand is CHEMBL1618631. Check out the elaboration below.
| CBD (Given Ligand) | CHEMBL1618631 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)cc2O | CC(C)NCc1cc(Br)ccc1OCc2ccccc2 |
|
|
|
|
|
|
| 00000001 43000008 20000102 00010202 00010000 40800000 02000001 00000602 00040900 00980842 08100000 40408840 00020002 00200000 00000400 00002008 00000000 02100020 00202000 00020a01 00000100 08000000 00008000 00400010 00200000 80000000 04404200 80000000 00000002 00024002 24020000 00010400 | 04004000 20008008 20000108 00010600 00001000 00004100 02000000 02001400 40000100 00100840 08200000 c0008000 00800812 00010000 01000501 02082008 00000000 02008000 00000000 00020000 00000040 08008020 00008000 00c01010 00004000 c0002000 00420000 80000000 00000300 00060000 44040008 08000200 |