On Target OPRM_HUMAN 0.45544556/CHEMBL437949
For the given ligand CBD, we have found in our database that, being scored 0.45544556, the most similar ligand is CHEMBL437949. Check out the elaboration below.
| CBD (Given Ligand) | CHEMBL437949 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)cc2O | Oc1cccc(c1)[C@@]23CCC[C@H](N(CCc4ccccc4)CC2)C3=C |
|
|
|
|
|
|
| 00000001 43000008 20000102 00010202 00010000 40800000 02000001 00000602 00040900 00980842 08100000 40408840 00020002 00200000 00000400 00002008 00000000 02100020 00202000 00020a01 00000100 08000000 00008000 00400010 00200000 80000000 04404200 80000000 00000002 00024002 24020000 00010400 | 00000000 43000608 20100102 00010600 00000000 40800000 02000001 20000400 10000880 001808c0 08300000 50018000 00000002 00210000 00000400 00040008 00004000 02100100 02002000 00020201 00000100 18200010 00000000 81500010 00000000 80000000 00080000 90000000 04000002 0006000a 24020000 02002600 |