On Target HRH2_HUMAN 0.31746033/CHEMBL490632
For the given ligand CBD, we have found in our database that, being scored 0.31746033, the most similar ligand is CHEMBL490632. Check out the elaboration below.
| CBD (Given Ligand) | CHEMBL490632 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)cc2O | COc1c(OCCF)cccc1C(=O)C2CCN(CCc3ccc(C)cc3)CC2 |
|
|
|
|
|
|
| 00000001 43000008 20000102 00010202 00010000 40800000 02000001 00000602 00040900 00980842 08100000 40408840 00020002 00200000 00000400 00002008 00000000 02100020 00202000 00020a01 00000100 08000000 00008000 00400010 00200000 80000000 04404200 80000000 00000002 00024002 24020000 00010400 | 06020000 43000808 2010010a 00210600 00001000 40020000 02000000 21000200 00100980 000808c0 08300000 50019840 0480c002 20200080 01004001 2208a008 00000000 02000000 00080400 00020201 00000100 18220200 00000000 81500414 00000000 c0000000 00000800 10000000 04000300 0006400a 80000000 00802600 |