On Target NK2R_HUMAN 0.29591838/CHEMBL17157
For the given ligand CBD, we have found in our database that, being scored 0.29591838, the most similar ligand is CHEMBL17157. Check out the elaboration below.
| CBD (Given Ligand) | CHEMBL17157 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)cc2O | CC(C)(C)c1ccc(cc1)C(O)CCCN2CCC(CC2)C(O)(c3ccccc3)c4ccccc4 |
|
|
|
|
|
|
| 00000001 43000008 20000102 00010202 00010000 40800000 02000001 00000602 00040900 00980842 08100000 40408840 00020002 00200000 00000400 00002008 00000000 02100020 00202000 00020a01 00000100 08000000 00008000 00400010 00200000 80000000 04404200 80000000 00000002 00024002 24020000 00010400 | 00000000 01000000 00100102 00050600 00100000 00004000 00000000 21000000 00100900 000808c0 08300000 50018800 00000002 00200000 00000000 00080008 00000000 02000000 00400000 00000201 00000100 18000020 01000000 00500010 00000000 a0000000 00000000 50000000 00000080 00060002 40000000 00002e00 |