On Target NK1R_HUMAN 0.40983605/CHEMBL2114439
For the given ligand CBD, we have found in our database that, being scored 0.40983605, the most similar ligand is CHEMBL2114439. Check out the elaboration below.
| CBD (Given Ligand) | CHEMBL2114439 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)cc2O | COc1ccccc1CN[C@H]2C3CCNC2(CC=C3C)c4ccccc4 |
|
|
|
|
|
|
| 00000001 43000008 20000102 00010202 00010000 40800000 02000001 00000602 00040900 00980842 08100000 40408840 00020002 00200000 00000400 00002008 00000000 02100020 00202000 00020a01 00000100 08000000 00008000 00400010 00200000 80000000 04404200 80000000 00000002 00024002 24020000 00010400 | 00000000 09000008 2010010a 04110600 00001000 00000100 02080000 22001402 10200880 001908ca 08300000 51038000 00020802 00202000 01000401 00002008 00004000 02000060 00002000 00020201 00000100 38208010 00008001 83500010 00200000 c0002000 00404000 90000000 0c000302 00060402 24060000 00012600 |