On Target CXCR3_HUMAN 0.32258064/CHEMBL2205064
For the given ligand CBD, we have found in our database that, being scored 0.32258064, the most similar ligand is CHEMBL2205064. Check out the elaboration below.
| CBD (Given Ligand) | CHEMBL2205064 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)cc2O | [I-].COc1ccc(cc1OC)c2ccc(C[N+](C)(C)CC3=CC[C@H]4C[C@@H]3C4(C)C)cc2 |
|
|
|
|
|
|
| 00000001 43000008 20000102 00010202 00010000 40800000 02000001 00000602 00040900 00980842 08100000 40408840 00020002 00200000 00000400 00002008 00000000 02100020 00202000 00020a01 00000100 08000000 00008000 00400010 00200000 80000000 04404200 80000000 00000002 00024002 24020000 00010400 | 00002010 41008008 20100108 00010600 00001000 00000000 02140000 22001402 00000100 001008c0 00200000 40018000 80024912 00010010 01000401 00008108 20020040 02000120 04082000 10021201 00000000 18008010 10008000 00500010 00200000 c0000000 004a4200 90000040 00004300 00060008 24261000 00000200 |