On Target CLTR1_HUMAN 0.3006993/CHEMBL1213917
For the given ligand CBD, we have found in our database that, being scored 0.3006993, the most similar ligand is CHEMBL1213917. Check out the elaboration below.
| CBD (Given Ligand) | CHEMBL1213917 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)cc2O | OC(=O)c1ccc(C(=O)\C=C\c2ccc(OCCCCOc3ccc(Cl)cc3)cc2)c(OCC#N)c1 |
|
|
|
|
|
|
| 00000001 43000008 20000102 00010202 00010000 40800000 02000001 00000602 00040900 00980842 08100000 40408840 00020002 00200000 00000400 00002008 00000000 02100020 00202000 00020a01 00000100 08000000 00008000 00400010 00200000 80000000 04404200 80000000 00000002 00024002 24020000 00010400 | 04008000 48000808 20100308 42050302 00201000 82824000 82040081 00000600 01840100 00b80840 08000000 40008820 02808006 00001080 11004007 200a2008 00400600 02108400 10498000 00020a01 00000000 08020b20 01008401 00400014 01202000 c0000000 00522800 40000000 00400300 00020002 c4000000 00020400 |