On Target ADA2A_HUMAN 0.34745762/CHEMBL256984
For the given ligand CBD, we have found in our database that, being scored 0.34745762, the most similar ligand is CHEMBL256984. Check out the elaboration below.
| CBD (Given Ligand) | CHEMBL256984 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)cc2O | COc1c(C)ccc2C(CCc12)c3ncc[nH]3 |
|
|
|
|
|
|
| 00000001 43000008 20000102 00010202 00010000 40800000 02000001 00000602 00040900 00980842 08100000 40408840 00020002 00200000 00000400 00002008 00000000 02100020 00202000 00020a01 00000100 08000000 00008000 00400010 00200000 80000000 04404200 80000000 00000002 00024002 24020000 00010400 | 0000000a 43000008 2000050a 10010600 00001041 40080000 03000010 00001201 00000900 000808c0 08108000 40008840 00000002 20201000 01020001 000e208c 00000000 06000001 00080008 00020201 00000100 18008000 21004000 00440410 00000000 c0000000 00000000 00000080 00000304 00c24802 40000000 20010400 |