On Target GRM3_HUMAN 0.37/CHEMBL124483
For the given ligand CBD, we have found in our database that, being scored 0.37, the most similar ligand is CHEMBL124483. Check out the elaboration below.
| CBD (Given Ligand) | CHEMBL124483 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)cc2O | N[C@](CCc1cccc(O)c1)(C2C[C@@H]2C(=O)O)C(=O)O |
|
|
|
|
|
|
| 00000001 43000008 20000102 00010202 00010000 40800000 02000001 00000602 00040900 00980842 08100000 40408840 00020002 00200000 00000400 00002008 00000000 02100020 00202000 00020a01 00000100 08000000 00008000 00400010 00200000 80000000 04404200 80000000 00000002 00024002 24020000 00010400 | 00030000 43000208 20000102 00010600 00180000 40000000 02000000 00000000 00000800 000a08c0 08100000 4001b000 0400803a 03a00000 00000000 00080008 00000000 02000000 00402000 00020201 00000100 18000a00 03000000 00400010 00000000 80000000 00000000 00000000 00000002 0006000a 00020000 00400400 |