On Target DRD3_HUMAN 0.627451/CHEMBL4082631
For the given ligand CBD, we have found in our database that, being scored 0.627451, the most similar ligand is CHEMBL4082631. Check out the elaboration below.
| CBD (Given Ligand) | CHEMBL4082631 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)cc2O | CCCC(C)(C)c1ccc2[C@@H]3C=C(C)CC[C@H]3C(C)(C)Oc2c1 |
|
|
|
|
|
|
| 00000001 43000008 20000102 00010202 00010000 40800000 02000001 00000602 00040900 00980842 08100000 40408840 00020002 00200000 00000400 00002008 00000000 02100020 00202000 00020a01 00000100 08000000 00008000 00400010 00200000 80000000 04404200 80000000 00000002 00024002 24020000 00010400 | 04000000 c3000018 2000010a 80010302 00081000 c2800000 02000001 00000602 00040900 00980848 08100000 40008840 00820002 20a00080 11000401 00082008 00800000 22108020 00682000 00022a01 00000100 08000000 01008040 00400410 00200000 c0000000 00404000 80000000 00000302 00024002 24020000 00000400 |