On Target ADRB1_HUMAN 0.32478634/CHEMBL26917
For the given ligand CBD, we have found in our database that, being scored 0.32478634, the most similar ligand is CHEMBL26917. Check out the elaboration below.
| CBD (Given Ligand) | CHEMBL26917 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)cc2O | CC(C)NCC(O)COc1ccc(C)c2CCCc12 |
|
|
|
|
|
|
| 00000001 43000008 20000102 00010202 00010000 40800000 02000001 00000602 00040900 00980842 08100000 40408840 00020002 00200000 00000400 00002008 00000000 02100020 00202000 00020a01 00000100 08000000 00008000 00400010 00200000 80000000 04404200 80000000 00000002 00024002 24020000 00010400 | 04000000 43000008 2010010a 00010600 00001081 c2000000 02040000 00000200 00000810 00080840 08300000 40008040 00800002 20201080 01200021 000a2008 10200000 22008000 00880000 00020201 00000100 18000000 07004080 08400410 00000001 c0000001 00020000 00800000 00000300 00064002 00000000 00000640 |