On Target 5HT1E_HUMAN 0.27388534/CHEMBL22744
For the given ligand CBD, we have found in our database that, being scored 0.27388534, the most similar ligand is CHEMBL22744. Check out the elaboration below.
| CBD (Given Ligand) | CHEMBL22744 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)cc2O | NC(=O)c1ccc2[nH]cc(C3=CCC(CC3)NCCCCCCCNC4CCC(=CC4)c5c[nH]c6ccc(cc56)C(=O)N)c2c1 |
|
|
|
|
|
|
| 00000001 43000008 20000102 00010202 00010000 40800000 02000001 00000602 00040900 00980842 08100000 40408840 00020002 00200000 00000400 00002008 00000000 02100020 00202000 00020a01 00000100 08000000 00008000 00400010 00200000 80000000 04404200 80000000 00000002 00024002 24020000 00010400 | 00000002 09008800 00100302 42810610 00041104 00000000 80082080 20001402 10500900 001828c8 08300004 41018800 88028802 00600800 00000442 00440004 00004400 02000064 00222400 00000203 41000100 1a068618 20808020 80500014 01042000 80000000 88406040 d0000000 04400002 00060c02 84060200 00002620 |