On Target NPY5R_HUMAN 0.45/CHEMBL469257
For the given ligand CBD, we have found in our database that, being scored 0.45, the most similar ligand is CHEMBL469257. Check out the elaboration below.
| CBD (Given Ligand) | CHEMBL469257 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)cc2O | CCc1ccc2C(C3=C(O)CC(C)(C)CC3=O)C4=C(CC(C)(C)CC4=O)Oc2c1 |
|
|
|
|
|
|
| 00000001 43000008 20000102 00010202 00010000 40800000 02000001 00000602 00040900 00980842 08100000 40408840 00020002 00200000 00000400 00002008 00000000 02100020 00202000 00020a01 00000100 08000000 00008000 00400010 00200000 80000000 04404200 80000000 00000002 00024002 24020000 00010400 | 04010002 43000008 2000010a 0001030a 00081800 82800000 06000081 00000602 01040908 009a8840 08900000 40009840 8482802a 20a00080 13000401 00083408 00800600 22108020 006d2008 0a020a01 00000101 18000288 01008000 0c480c10 00600800 c0000000 00405040 80000000 00004302 8002400a 24060000 00000400 |