On Target CXCR1_HUMAN 0.24712643/CHEMBL254370
For the given ligand CBD, we have found in our database that, being scored 0.24712643, the most similar ligand is CHEMBL254370. Check out the elaboration below.
| CBD (Given Ligand) | CHEMBL254370 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)cc2O | CC[C@@H](NC1=C(Nc2cccc(C(=O)N(C)C)c2O)C(=O)C1=O)c3ccccc3 |
|
|
|
|
|
|
| 00000001 43000008 20000102 00010202 00010000 40800000 02000001 00000602 00040900 00980842 08100000 40408840 00020002 00200000 00000400 00002008 00000000 02100020 00202000 00020a01 00000100 08000000 00008000 00400010 00200000 80000000 04404200 80000000 00000002 00024002 24020000 00010400 | 1040c002 00000808 60100102 00012600 20010001 68022000 020000a0 22401500 05a00c40 001808d0 08380004 5042b000 0a008802 00200000 80020440 10006048 00050001 22008000 08230210 20020201 48100980 18128600 20000000 00408014 04041000 c0000080 20400010 900c0580 20508102 20060003 a4045420 40002600 |