On Target DRD5_HUMAN 0.33870968/CHEMBL604314
For the given ligand CBD, we have found in our database that, being scored 0.33870968, the most similar ligand is CHEMBL604314. Check out the elaboration below.
| CBD (Given Ligand) | CHEMBL604314 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)cc2O | CN1CCc2cc(Cl)c(O)cc2[C@@H]3[C@@H]1CCc4c(O)cccc34 |
|
|
|
|
|
|
| 00000001 43000008 20000102 00010202 00010000 40800000 02000001 00000602 00040900 00980842 08100000 40408840 00020002 00200000 00000400 00002008 00000000 02100020 00202000 00020a01 00000100 08000000 00008000 00400010 00200000 80000000 04404200 80000000 00000002 00024002 24020000 00010400 | 00008000 47000208 20100102 00010600 00000020 c0000002 06000400 21000201 04000880 000808c0 08300000 40808840 02000026 00200000 80000020 02042008 00000200 02100000 00102000 00020201 00000100 18200100 00004000 814a0010 00002000 a0000801 00160000 50000000 06000082 0006c00a 00000000 00022600 |