On Target CCKAR_HUMAN 0.2027027/CHEMBL250974
For the given ligand CBD, we have found in our database that, being scored 0.2027027, the most similar ligand is CHEMBL250974. Check out the elaboration below.
| CBD (Given Ligand) | CHEMBL250974 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)cc2O | COc1ccc(Cn2c(CCc3ccccc3)nnc2[C@H](NC(=O)c4ccccn4)c5c[nH]c6ccccc56)c(OC)c1 |
|
|
|
|
|
|
| 00000001 43000008 20000102 00010202 00010000 40800000 02000001 00000602 00040900 00980842 08100000 40408840 00020002 00200000 00000400 00002008 00000000 02100020 00202000 00020a01 00000100 08000000 00008000 00400010 00200000 80000000 04404200 80000000 00000002 00024002 24020000 00010400 | 12000003 01800808 6010530a 50010e10 01041020 00180106 42846000 0e003603 80400d80 101c0840 09398124 46008840 00009806 00500000 01830441 020c210c 5002a408 06000027 00680408 00271841 c0000501 3843ae08 25802040 8144041c 00156810 c0000600 08220040 80031000 04080304 00060003 a6048280 a0004620 |