On Target OPRX_HUMAN 0.375/CHEMBL3785718
For the given ligand CBD, we have found in our database that, being scored 0.375, the most similar ligand is CHEMBL3785718. Check out the elaboration below.
| CBD (Given Ligand) | CHEMBL3785718 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)cc2O | Oc1cccc2CC(CN3CCC4(CC3)CCc5ccccc45)NCc12 |
|
|
|
|
|
|
| 00000001 43000008 20000102 00010202 00010000 40800000 02000001 00000602 00040900 00980842 08100000 40408840 00020002 00200000 00000400 00002008 00000000 02100020 00202000 00020a01 00000100 08000000 00008000 00400010 00200000 80000000 04404200 80000000 00000002 00024002 24020000 00010400 | 00000008 43000208 20100102 14010600 00000020 c0000002 02000000 22001401 00000880 001908c0 08300000 50018000 00000802 00203000 00000400 02062008 00000000 02000020 00002000 00020201 00020100 38208010 00004001 83500010 00000000 c0000001 00004000 90000000 0c000102 0086000a 24040000 00002600 |