On Target GRM4_HUMAN 0.2029703/CHEMBL2063423
For the given ligand CBD, we have found in our database that, being scored 0.2029703, the most similar ligand is CHEMBL2063423. Check out the elaboration below.
| CBD (Given Ligand) | CHEMBL2063423 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)cc2O | O\N=C\1/[C@@H]2C[C@@]2(Oc3ccccc13)C(=O)Nc4ccccn4 |
|
|
|
|
|
|
| 00000001 43000008 20000102 00010202 00010000 40800000 02000001 00000602 00040900 00980842 08100000 40408840 00020002 00200000 00000400 00002008 00000000 02100020 00202000 00020a01 00000100 08000000 00008000 00400010 00200000 80000000 04404200 80000000 00000002 00024002 24020000 00010400 | 04016003 01000038 6398710a 00050f02 204c1080 82003000 02000140 10106202 00110940 200908c1 083d0004 4001d040 0484980a 01300000 11021009 000c201c 00840000 a202c000 08606000 00a20001 40140100 1c068610 33802840 00700410 00000000 c0000000 48200088 12000080 0004830b 00064803 40081000 00440701 |