On Target VIPR1_HUMAN 0.18229167/CHEMBL483749
For the given ligand CBD, we have found in our database that, being scored 0.18229167, the most similar ligand is CHEMBL483749. Check out the elaboration below.
| CBD (Given Ligand) | CHEMBL483749 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)cc2O | O=C(NN1CCCCC1)c2ccc3Sc4ccccc4C(=Nc3c2)C5CCCCC5 |
|
|
|
|
|
|
| 00000001 43000008 20000102 00010202 00010000 40800000 02000001 00000602 00040900 00980842 08100000 40408840 00020002 00200000 00000400 00002008 00000000 02100020 00202000 00020a01 00000100 08000000 00008000 00400010 00200000 80000000 04404200 80000000 00000002 00024002 24020000 00010400 | 00000006 09841a80 00120902 08110e20 00040007 00000022 10000010 00007002 02900900 000808c9 0831002c 70018810 0a008802 40218000 200000c0 10080004 04001810 02000005 06202010 00020201 c0000101 1a0b8600 61804002 0048881d 000c7200 88100000 40000410 18000000 0148020a 014f0002 c0060100 001506a8 |