On Target BKRB2_HUMAN 0.20731707/CHEMBL1162797
For the given ligand CBD, we have found in our database that, being scored 0.20731707, the most similar ligand is CHEMBL1162797. Check out the elaboration below.
| CBD (Given Ligand) | CHEMBL1162797 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)cc2O | Cl.Cl.CCCCP(CCCC)(CCCC)Cc1ccc(\C=C/[C@H](Cc2ccc3ccccc3c2)N\C(=N\C4CCCCC4)\NC5CCCCC5)cc1 |
|
|
|
|
|
|
| 00000001 43000008 20000102 00010202 00010000 40800000 02000001 00000602 00040900 00980842 08100000 40408840 00020002 00200000 00000400 00002008 00000000 02100020 00202000 00020a01 00000100 08000000 00008000 00400010 00200000 80000000 04404200 80000000 00000002 00024002 24020000 00010400 | 00000040 01008200 00100300 00110e00 00040040 00200000 80010084 24002400 00000f00 015808c2 18300011 40118000 00021600 00010008 02010002 00100000 22009c08 02000500 02102040 00800201 01002100 38210018 00008021 a3500011 01010000 80010002 40412000 d0010000 0e400210 00060302 94080000 0003c600 |