On Target CCR2_HUMAN 0.51578945/CHEMBL3754764
For the given ligand CBD, we have found in our database that, being scored 0.51578945, the most similar ligand is CHEMBL3754764. Check out the elaboration below.
| CBD (Given Ligand) | CHEMBL3754764 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)cc2O | C[C@H]1CC=C(C(=O)O)[C@@](C)(C1)c2ccc(C)c3ccccc23 |
|
|
|
|
|
|
| 00000001 43000008 20000102 00010202 00010000 40800000 02000001 00000602 00040900 00980842 08100000 40408840 00020002 00200000 00000400 00002008 00000000 02100020 00202000 00020a01 00000100 08000000 00008000 00400010 00200000 80000000 04404200 80000000 00000002 00024002 24020000 00010400 | 00010000 01000000 00000102 00010200 00080000 00800000 00000081 08000402 01000900 00980840 08100000 40009800 04028008 00a00000 00000400 00080008 00000000 02100020 00612018 00000801 00000100 08000a88 01008040 00400010 00201800 80000400 00404000 80000000 00000002 00020002 24020000 00000400 |