On Target CXCR2_HUMAN 0.28057554/CHEMBL3645131
For the given ligand CBD, we have found in our database that, being scored 0.28057554, the most similar ligand is CHEMBL3645131. Check out the elaboration below.
| CBD (Given Ligand) | CHEMBL3645131 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)cc2O | CC(CCc1ccccc1)Oc2c(ccc3ccccc23)C(=O)NC4(CCCC4)C(=O)O |
|
|
|
|
|
|
| 00000001 43000008 20000102 00010202 00010000 40800000 02000001 00000602 00040900 00980842 08100000 40408840 00020002 00200000 00000400 00002008 00000000 02100020 00202000 00020a01 00000100 08000000 00008000 00400010 00200000 80000000 04404200 80000000 00000002 00024002 24020000 00010400 | 04018008 01005808 2010010a 00010700 00081080 02020100 02000000 22001400 00000800 001808c0 08300000 4001b020 0680880a 00a00000 11000401 00082008 10000000 22008000 00402000 00020201 00000140 18068e08 03000040 0050001c 00000000 c0000000 00000800 90000000 00000300 01060003 a4044000 00000600 |