On Target MC5R_HUMAN 0.25/CHEMBL3913861
For the given ligand CBD, we have found in our database that, being scored 0.25, the most similar ligand is CHEMBL3913861. Check out the elaboration below.
| CBD (Given Ligand) | CHEMBL3913861 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)cc2O | CC[C@H](CN1CC[C@H](CNC(=O)c2ccc3ccccc3c2OC)N[C@H](CCN4CCCCC4)C1=O)c5ccccc5 |
|
|
|
|
|
|
| 00000001 43000008 20000102 00010202 00010000 40800000 02000001 00000602 00040900 00980842 08100000 40408840 00020002 00200000 00000400 00002008 00000000 02100020 00202000 00020a01 00000100 08000000 00008000 00400010 00200000 80000000 04404200 80000000 00000002 00024002 24020000 00010400 | 00020000 01003c08 20100108 04010600 00001000 00020100 02000000 2200140c 00200880 001909e0 08300000 5003b000 06008802 00002001 81000401 00002008 00000000 02000000 00000000 00020201 08000100 382e8608 00000003 8350001c 00000000 c0000000 00000800 90000000 0c000300 00060013 a4044000 00802600 |