On Target EDNRA_HUMAN 0.4431818/CHEMBL31662
For the given ligand test, we have found in our database that, being scored 0.4431818, the most similar ligand is CHEMBL31662. Check out the elaboration below.
| test (Given Ligand) | CHEMBL31662 (Similar Ligand) |
|---|---|
| CCCCCc2cccc(c1ccccc1)c2 | CCc1ccc(cc1)c2ccc3[C@H]4[C@H]([C@H]([C@H]4c5ccccc5C(=O)c3c2)C(=O)O)C(=O)O |
|
|
|
|
|
|
| 00002000 01000000 00000102 00010200 00000001 00000000 00000000 00000000 00000800 00080840 08100000 40008000 00000000 00200000 00000000 00080008 00020000 02001000 04002000 00000001 00000100 08000000 11000000 00400010 00000000 80000080 00000000 00000041 00004002 00020002 00000000 00000400 | 00052000 01000800 00000102 00010200 00280001 00008002 01001400 01000001 04000900 00080840 08100000 40009a00 04008008 00a00010 00000020 08080008 00020000 02001000 04502008 10000001 00400100 08120a40 11404040 00400814 00000800 a0000081 00000000 40000041 12004082 00020002 80000000 00400500 |