On Target V1AR_HUMAN 0.28089887/CHEMBL1084823
For the given ligand test, we have found in our database that, being scored 0.28089887, the most similar ligand is CHEMBL1084823. Check out the elaboration below.
| test (Given Ligand) | CHEMBL1084823 (Similar Ligand) |
|---|---|
| CCCCCc2cccc(c1ccccc1)c2 | Cc1ccccc1c2ccc(cc2C)C(=O)N3C[C@]4(C)C[C@H]3CC(C)(C)C4 |
|
|
|
|
|
|
| 00002000 01000000 00000102 00010200 00000001 00000000 00000000 00000000 00000800 00080840 08100000 40008000 00000000 00200000 00000000 00080008 00020000 02001000 04002000 00000001 00000100 08000000 11000000 00400010 00000000 80000080 00000000 00000041 00004002 00020002 00000000 00000400 | 00002000 01001801 00100100 40010600 00000001 00000010 10000000 22001000 00000100 000008c0 00200000 40018000 80008802 00200000 20000400 08000008 00020000 02000000 06002000 90200201 00000000 18068610 10000000 0050001c 00000000 c0000000 08000000 90000040 00004100 00060001 a0060000 00002200 |