On Target AA2BR_HUMAN 0.24038461/CHEMBL222719
For the given ligand test, we have found in our database that, being scored 0.24038461, the most similar ligand is CHEMBL222719. Check out the elaboration below.
| test (Given Ligand) | CHEMBL222719 (Similar Ligand) |
|---|---|
| CCCCCc2cccc(c1ccccc1)c2 | CCCC(=O)Nc1nc(cc(n1)c2ccccc2)c3ccccc3 |
|
|
|
|
|
|
| 00002000 01000000 00000102 00010200 00000001 00000000 00000000 00000000 00000800 00080840 08100000 40008000 00000000 00200000 00000000 00080008 00020000 02001000 04002000 00000001 00000100 08000000 11000000 00400010 00000000 80000080 00000000 00000041 00004002 00020002 00000000 00000400 | 0000a002 00000800 80180100 00050600 01000004 00004000 00002000 00180000 00000100 200008c0 00302004 60009800 06808000 00100000 00020000 000c000c 00020000 02007000 04400000 00a00001 00000000 1c022600 30802840 00400118 00000000 81000000 00000000 10000061 0000400c 00460801 40001800 000003a0 |