On Target DRD2_HUMAN 0.44047618/CHEMBL314536
For the given ligand test, we have found in our database that, being scored 0.44047618, the most similar ligand is CHEMBL314536. Check out the elaboration below.
| test (Given Ligand) | CHEMBL314536 (Similar Ligand) |
|---|---|
| CCCCCc2cccc(c1ccccc1)c2 | CCCN1CCC[C@H](C1)c2cccc(c2)c3ccsc3 |
|
|
|
|
|
|
| 00002000 01000000 00000102 00010200 00000001 00000000 00000000 00000000 00000800 00080840 08100000 40008000 00000000 00200000 00000000 00080008 00020000 02001000 04002000 00000001 00000100 08000000 11000000 00400010 00000000 80000080 00000000 00000041 00004002 00020002 00000000 00000400 | 00012000 01000000 00100902 00010600 00101001 00000010 40000000 20000080 00100880 000808c0 08300200 50018080 0000000a 00200001 00001001 00080008 00020000 02001000 0c000000 00000201 00000100 58240080 11000000 81500010 00800000 84100080 00000000 10000045 04004000 00060002 00000000 00c12600 |