On Target PTAFR_HUMAN 0.34117648/CHEMBL297624
For the given ligand test, we have found in our database that, being scored 0.34117648, the most similar ligand is CHEMBL297624. Check out the elaboration below.
| test (Given Ligand) | CHEMBL297624 (Similar Ligand) |
|---|---|
| CCCCCc2cccc(c1ccccc1)c2 | COc1cc(cc(OC)c1OC)[C@H]2CC[C@@H](O2)c3cc(OC)c(OC)c(OC)c3 |
|
|
|
|
|
|
| 00002000 01000000 00000102 00010200 00000001 00000000 00000000 00000000 00000800 00080840 08100000 40008000 00000000 00200000 00000000 00080008 00020000 02001000 04002000 00000001 00000100 08000000 11000000 00400010 00000000 80000080 00000000 00000041 00004002 00020002 00000000 00000400 | 00000001 4b000008 2000010a 00010200 00081010 40004000 42040000 00000000 00000900 00080848 08100000 40008000 00004002 20210000 01080005 02088008 00000000 02000204 00482000 00020a01 00000120 08000020 01000000 00400010 00000400 80002000 005a0000 00000000 00000202 0002000a 40000000 02000400 |