On Target DRD3_HUMAN 0.45901638/CHEMBL93234
For the given ligand test, we have found in our database that, being scored 0.45901638, the most similar ligand is CHEMBL93234. Check out the elaboration below.
| test (Given Ligand) | CHEMBL93234 (Similar Ligand) |
|---|---|
| CCCCCc2cccc(c1ccccc1)c2 | CCCN1CCC[C@H](C1)c2cccc(C)c2 |
|
|
|
|
|
|
| 00002000 01000000 00000102 00010200 00000001 00000000 00000000 00000000 00000800 00080840 08100000 40008000 00000000 00200000 00000000 00080008 00020000 02001000 04002000 00000001 00000100 08000000 11000000 00400010 00000000 80000080 00000000 00000041 00004002 00020002 00000000 00000400 | 00000000 01000000 00100102 00010600 00001001 00000000 00000000 20000000 00100880 000808c0 08300000 50018000 00000002 00200000 00000000 00080008 00000000 02000000 00000000 00000201 00000100 18200000 01000000 81500010 00000000 80000000 00000000 10000000 04000000 00060002 00000000 00002600 |