On Target ADRB1_HUMAN 0.443038/CHEMBL451760
For the given ligand test, we have found in our database that, being scored 0.443038, the most similar ligand is CHEMBL451760. Check out the elaboration below.
| test (Given Ligand) | CHEMBL451760 (Similar Ligand) |
|---|---|
| CCCCCc2cccc(c1ccccc1)c2 | CC(C)Cc1cc(ccc1C(=O)O)c2ccc(CCN[C@@H](C)[C@H](O)c3ccccc3)cc2 |
|
|
|
|
|
|
| 00002000 01000000 00000102 00010200 00000001 00000000 00000000 00000000 00000800 00080840 08100000 40008000 00000000 00200000 00000000 00080008 00020000 02001000 04002000 00000001 00000100 08000000 11000000 00400010 00000000 80000080 00000000 00000041 00004002 00020002 00000000 00000400 | 00002000 00000800 00100100 40050600 00000081 0000c000 00000000 00000000 00000980 00080840 08300000 40008800 00008002 00200000 00080000 00080008 10020000 02001000 04000000 10000201 00400500 18220a60 13004000 81400014 00000000 80000281 00000000 00000041 04004000 00060002 c0000000 00002600 |