On Target AGTR2_HUMAN 0.30701753/CHEMBL290286
For the given ligand test, we have found in our database that, being scored 0.30701753, the most similar ligand is CHEMBL290286. Check out the elaboration below.
| test (Given Ligand) | CHEMBL290286 (Similar Ligand) |
|---|---|
| CCCCCc2cccc(c1ccccc1)c2 | OC(=O)[C@@H]1Cc2cc(ccc2CN1C(=O)C(c3ccccc3)c4ccccc4)c5ccccc5 |
|
|
|
|
|
|
| 00002000 01000000 00000102 00010200 00000001 00000000 00000000 00000000 00000800 00080840 08100000 40008000 00000000 00200000 00000000 00080008 00020000 02001000 04002000 00000001 00000100 08000000 11000000 00400010 00000000 80000080 00000000 00000041 00004002 00020002 00000000 00000400 | 0000a008 00805000 00100100 10010600 000010a1 00000000 01001000 03001004 00000980 00080840 08300000 4000b000 87008882 00200000 c0080480 00080008 10020200 02001020 04400008 10000201 80020100 18208e00 13004040 81400018 00000800 e0000081 00004000 c0000041 04004180 00860003 20046000 00002600 |